About ethyl decanoate;methanol
ethyl decanoate;methanol (PubChem CID 161391102) has the molecular formula C13H28O3
and a molecular weight of 232.36 g/mol. Its IUPAC name is ethyl decanoate;methanol.
Molecular Properties
| Compound Name | ethyl decanoate;methanol |
| PubChem CID | 161391102 |
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | ethyl decanoate;methanol |
| SMILES | CCCCCCCCCC(=O)OCC.CO |
| InChI | InChI=1S/C12H24O2.CH4O/c1-3-5-6-7-8-9-10-11-12(13)14-4-2;1-2/h3-11H2,1-2H3;2H,1H3 |
| InChIKey | VSZNVKJTOXPNHN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl decanoate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl decanoate;methanol?
The IUPAC name of ethyl decanoate;methanol (CID 161391102) is ethyl decanoate;methanol.
What is the SMILES notation for ethyl decanoate;methanol?
The canonical SMILES for ethyl decanoate;methanol is CCCCCCCCCC(=O)OCC.CO.
What is the InChIKey of ethyl decanoate;methanol?
The InChIKey is VSZNVKJTOXPNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.CH4O/c1-3-5-6-7-8-9-10-11-12(13)14-4-2;1-2/h3-11H2,1-2H3;2H,1H3.
What are the key properties of ethyl decanoate;methanol?
ethyl decanoate;methanol has a molecular weight of 232.36 g/mol, XLogP of 3.30, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl decanoate;methanol is sourced from PubChem (CID 161391102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).