C28H27N5O3 — CID 161392922
N'-[2-[5-[4-(4-cyanophenyl)piperidine-1-carbonyl]-2-methylphenyl]acetyl]pyridine-4-carbohydrazide (PubChem CID 161392922) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is N'-[2-[5-[4-(4-cyanophenyl)piperidine-1-carbonyl]-2-methylphenyl]acetyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[2-[5-[4-(4-cyanophenyl)piperidine-1-carbonyl]-2-methylphenyl]acetyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 161392922 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N'-[2-[5-[4-(4-cyanophenyl)piperidine-1-carbonyl]-2-methylphenyl]acetyl]pyridine-4-carbohydrazide |
| SMILES | Cc1ccc(C(=O)N2CCC(c3ccc(C#N)cc3)CC2)cc1CC(=O)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C28H27N5O3/c1-19-2-5-24(16-25(19)17-26(34)31-32-27(35)23-8-12-30-13-9-23)28(36)33-14-10-22(11-15-33)21-6-3-20(18-29)4-7-21/h2-9,12-13,16,22H,10-11,14-15,17H2,1H3,(H,31,34)(H,32,35) |
| InChIKey | TXJNOLPAOJZSMI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|