C17H16I2OV — CID 161393105
(E)-1,3-bis(4-methylphenyl)prop-2-en-1-one;diiodovanadium (PubChem CID 161393105) has the molecular formula C17H16I2OV and a molecular weight of 541.07 g/mol. Its IUPAC name is (E)-1,3-bis(4-methylphenyl)prop-2-en-1-one;diiodovanadium.
| Compound Name | (E)-1,3-bis(4-methylphenyl)prop-2-en-1-one;diiodovanadium |
|---|---|
| PubChem CID | 161393105 |
| Molecular Formula | C17H16I2OV |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.87 |
| IUPAC Name | (E)-1,3-bis(4-methylphenyl)prop-2-en-1-one;diiodovanadium |
| SMILES | Cc1ccc(/C=C/C(=O)c2ccc(C)cc2)cc1.I[V]I |
| InChI | InChI=1S/C17H16O.2HI.V/c1-13-3-7-15(8-4-13)9-12-17(18)16-10-5-14(2)6-11-16;;;/h3-12H,1-2H3;2*1H;/q;;;+2/p-2/b12-9+;;; |
| InChIKey | VTGDORJHUOHEBK-MRPQEHAPSA-L |
| XLogP | 5.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|