C33H51N7O5 — CID 161393208
N-[(8R,11R,18R)-8-[3-(diaminomethylideneamino)propyl]-11-methyl-18-(4-methylphenyl)-7,10,17,20-tetraoxo-6,16,19-triazaspiro[4.15]icosan-11-yl]-2-methylpropanamide (PubChem CID 161393208) has the molecular formula C33H51N7O5 and a molecular weight of 625.82 g/mol. Its IUPAC name is N-[(8R,11R,18R)-8-[3-(diaminomethylideneamino)propyl]-11-methyl-18-(4-methylphenyl)-7,10,17,20-tetraoxo-6,16,19-triazaspiro[4.15]icosan-11-yl]-2-methylpropanamide.
| Compound Name | N-[(8R,11R,18R)-8-[3-(diaminomethylideneamino)propyl]-11-methyl-18-(4-methylphenyl)-7,10,17,20-tetraoxo-6,16,19-triazaspiro[4.15]icosan-11-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 161393208 |
| Molecular Formula | C33H51N7O5 |
| Molecular Weight | 625.82 g/mol |
| Exact Mass | 625.40 |
| IUPAC Name | N-[(8R,11R,18R)-8-[3-(diaminomethylideneamino)propyl]-11-methyl-18-(4-methylphenyl)-7,10,17,20-tetraoxo-6,16,19-triazaspiro[4.15]icosan-11-yl]-2-methylpropanamide |
| SMILES | Cc1ccc([C@H]2NC(=O)C3(CCCC3)NC(=O)[C@H](CCCN=C(N)N)CC(=O)[C@](C)(NC(=O)C(C)C)CCCCNC2=O)cc1 |
| InChI | InChI=1S/C33H51N7O5/c1-21(2)27(42)39-32(4)15-7-8-18-36-29(44)26(23-13-11-22(3)12-14-23)38-30(45)33(16-5-6-17-33)40-28(43)24(20-25(32)41)10-9-19-37-31(34)35/h11-14,21,24,26H,5-10,15-20H2,1-4H3,(H,36,44)(H,38,45)(H,39,42)(H,40,43)(H4,34,35,37)/t24-,26-,32-/m1/s1 |
| InChIKey | LWXQQRJMPBZIQE-GOBFPGLISA-N |
| XLogP | 2.04 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.82 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|