About 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine
1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine (PubChem CID 161393633) has the molecular formula C24H41N3
and a molecular weight of 371.61 g/mol. Its IUPAC name is 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine.
Molecular Properties
| Compound Name | 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine |
| PubChem CID | 161393633 |
| Molecular Formula | C24H41N3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.33 |
| IUPAC Name | 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine |
| SMILES | CC(C)(C)c1ccnc(C(C)(C)C)c1.CC(C)(C)c1cnn(C(C)(C)C)c1 |
| InChI | InChI=1S/C13H21N.C11H20N2/c1-12(2,3)10-7-8-14-11(9-10)13(4,5)6;1-10(2,3)9-7-12-13(8-9)11(4,5)6/h7-9H,1-6H3;7-8H,1-6H3 |
| InChIKey | VTHUTTCFWBRAJB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine?
The IUPAC name of 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine (CID 161393633) is 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine.
What is the SMILES notation for 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine?
The canonical SMILES for 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine is CC(C)(C)c1ccnc(C(C)(C)C)c1.CC(C)(C)c1cnn(C(C)(C)C)c1.
What is the InChIKey of 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine?
The InChIKey is VTHUTTCFWBRAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N.C11H20N2/c1-12(2,3)10-7-8-14-11(9-10)13(4,5)6;1-10(2,3)9-7-12-13(8-9)11(4,5)6/h7-9H,1-6H3;7-8H,1-6H3.
What are the key properties of 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine?
1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine has a molecular weight of 371.61 g/mol, XLogP of 6.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butylpyrazole;2,4-ditert-butylpyridine is sourced from PubChem (CID 161393633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).