C30H25Cl2IN6O2 — CID 161394022
6-chloro-3-ethenyl-1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridine;6-chloro-3-iodo-1-[(4-methoxyphenyl)methyl]pyrazolo[5,4-b]pyridine (PubChem CID 161394022) has the molecular formula C30H25Cl2IN6O2 and a molecular weight of 699.38 g/mol. Its IUPAC name is 6-chloro-3-ethenyl-1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridine;6-chloro-3-iodo-1-[(4-methoxyphenyl)methyl]pyrazolo[5,4-b]pyridine.
| Compound Name | 6-chloro-3-ethenyl-1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridine;6-chloro-3-iodo-1-[(4-methoxyphenyl)methyl]pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 161394022 |
| Molecular Formula | C30H25Cl2IN6O2 |
| Molecular Weight | 699.38 g/mol |
| Exact Mass | 698.05 |
| IUPAC Name | 6-chloro-3-ethenyl-1-[(4-methoxyphenyl)methyl]pyrazolo[3,4-b]pyridine;6-chloro-3-iodo-1-[(4-methoxyphenyl)methyl]pyrazolo[5,4-b]pyridine |
| SMILES | C=Cc1nn(Cc2ccc(OC)cc2)c2nc(Cl)ccc12.COc1ccc(Cn2nc(I)c3ccc(Cl)nc32)cc1 |
| InChI | InChI=1S/C16H14ClN3O.C14H11ClIN3O/c1-3-14-13-8-9-15(17)18-16(13)20(19-14)10-11-4-6-12(21-2)7-5-11;1-20-10-4-2-9(3-5-10)8-19-14-11(13(16)18-19)6-7-12(15)17-14/h3-9H,1,10H2,2H3;2-7H,8H2,1H3 |
| InChIKey | VTIXMNMDQHPGNS-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.38 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|