About [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol
[5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol (PubChem CID 161397004) has the molecular formula C10H16S6
and a molecular weight of 328.64 g/mol. Its IUPAC name is [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol.
Molecular Properties
| Compound Name | [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol |
| PubChem CID | 161397004 |
| Molecular Formula | C10H16S6 |
| Molecular Weight | 328.64 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol |
| SMILES | SCC1CCC(CS)S1.Sc1cscc1S |
| InChI | InChI=1S/C6H12S3.C4H4S3/c7-3-5-1-2-6(4-8)9-5;5-3-1-7-2-4(3)6/h5-8H,1-4H2;1-2,5-6H |
| InChIKey | VTSQRCYWLAXLEA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol?
The IUPAC name of [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol (CID 161397004) is [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol.
What is the SMILES notation for [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol?
The canonical SMILES for [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol is SCC1CCC(CS)S1.Sc1cscc1S.
What is the InChIKey of [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol?
The InChIKey is VTSQRCYWLAXLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12S3.C4H4S3/c7-3-5-1-2-6(4-8)9-5;5-3-1-7-2-4(3)6/h5-8H,1-4H2;1-2,5-6H.
What are the key properties of [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol?
[5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol has a molecular weight of 328.64 g/mol, XLogP of 4.44, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(sulfanylmethyl)thiolan-2-yl]methanethiol;thiophene-3,4-dithiol is sourced from PubChem (CID 161397004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).