About 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride
2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride (PubChem CID 161398257) has the molecular formula C6H18Cl2N3-
and a molecular weight of 203.14 g/mol. Its IUPAC name is 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride.
Molecular Properties
| Compound Name | 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride |
| PubChem CID | 161398257 |
| Molecular Formula | C6H18Cl2N3- |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride |
| SMILES | C[N+](C)(CCN)CCCl.[Cl-].[NH2-] |
| InChI | InChI=1S/C6H16ClN2.ClH.H2N/c1-9(2,5-3-7)6-4-8;;/h3-6,8H2,1-2H3;1H;1H2/q+1;;-1/p-1 |
| InChIKey | CPBOVRJKMSQFCR-UHFFFAOYSA-M |
| XLogP | -2.02 |
| TPSA | 59.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride?
The IUPAC name of 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride (CID 161398257) is 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride.
What is the SMILES notation for 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride?
The canonical SMILES for 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride is C[N+](C)(CCN)CCCl.[Cl-].[NH2-].
What is the InChIKey of 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride?
The InChIKey is CPBOVRJKMSQFCR-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H16ClN2.ClH.H2N/c1-9(2,5-3-7)6-4-8;;/h3-6,8H2,1-2H3;1H;1H2/q+1;;-1/p-1.
What are the key properties of 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride?
2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride has a molecular weight of 203.14 g/mol, XLogP of -2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl-(2-chloroethyl)-dimethylazanium;azanide;chloride is sourced from PubChem (CID 161398257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).