1-ethenylpyrrolidin-2-one;nitric acid

C6H10N2O4 — CID 161399380

IUPAC1-ethenylpyrrolidin-2-one;nitric acid
SMILESC=CN1CCCC1=O.O=[N+]([O-])O
InChIInChI=1S/C6H9NO.HNO3/c1-2-7-5-3-4-6(7)8;2-1(3)4/h2H,1,3-5H2;(H,2,3,4)
InChIKeyVUANBEVWFKGNML-UHFFFAOYSA-N
MW174.16 g/mol
LogP0.40
Rot. Bonds1

About 1-ethenylpyrrolidin-2-one;nitric acid

1-ethenylpyrrolidin-2-one;nitric acid (PubChem CID 161399380) has the molecular formula C6H10N2O4 and a molecular weight of 174.16 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;nitric acid.

Molecular Properties

Compound Name1-ethenylpyrrolidin-2-one;nitric acid
PubChem CID161399380
Molecular FormulaC6H10N2O4
Molecular Weight174.16 g/mol
Exact Mass174.06
IUPAC Name1-ethenylpyrrolidin-2-one;nitric acid
SMILESC=CN1CCCC1=O.O=[N+]([O-])O
InChIInChI=1S/C6H9NO.HNO3/c1-2-7-5-3-4-6(7)8;2-1(3)4/h2H,1,3-5H2;(H,2,3,4)
InChIKeyVUANBEVWFKGNML-UHFFFAOYSA-N
XLogP0.40
TPSA83.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.16
LogP ≤ 50.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-ethenylpyrrolidin-2-one;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethenylpyrrolidin-2-one;nitric acid?
The IUPAC name of 1-ethenylpyrrolidin-2-one;nitric acid (CID 161399380) is 1-ethenylpyrrolidin-2-one;nitric acid.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;nitric acid?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;nitric acid is C=CN1CCCC1=O.O=[N+]([O-])O.
What is the InChIKey of 1-ethenylpyrrolidin-2-one;nitric acid?
The InChIKey is VUANBEVWFKGNML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.HNO3/c1-2-7-5-3-4-6(7)8;2-1(3)4/h2H,1,3-5H2;(H,2,3,4).
What are the key properties of 1-ethenylpyrrolidin-2-one;nitric acid?
1-ethenylpyrrolidin-2-one;nitric acid has a molecular weight of 174.16 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;nitric acid is sourced from PubChem (CID 161399380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).