C30H27FN2O5S — CID 161399982
1-[3-fluoro-4-[2-(pyrrolidine-1-carbonyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione (PubChem CID 161399982) has the molecular formula C30H27FN2O5S and a molecular weight of 546.62 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-(pyrrolidine-1-carbonyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione.
| Compound Name | 1-[3-fluoro-4-[2-(pyrrolidine-1-carbonyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 161399982 |
| Molecular Formula | C30H27FN2O5S |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 1-[3-fluoro-4-[2-(pyrrolidine-1-carbonyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione |
| SMILES | COc1ccccc1CC(=O)CC(=O)Cc1ccc(Oc2ccnc3cc(C(=O)N4CCCC4)sc23)c(F)c1 |
| InChI | InChI=1S/C30H27FN2O5S/c1-37-25-7-3-2-6-20(25)16-22(35)17-21(34)14-19-8-9-26(23(31)15-19)38-27-10-11-32-24-18-28(39-29(24)27)30(36)33-12-4-5-13-33/h2-3,6-11,15,18H,4-5,12-14,16-17H2,1H3 |
| InChIKey | OCMRLGIAUDAXSJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|