About pyridine;pentakis(1H-pyrrole);quinazoline
pyridine;pentakis(1H-pyrrole);quinazoline (PubChem CID 161401177) has the molecular formula C33H36N8
and a molecular weight of 544.71 g/mol. Its IUPAC name is pyridine;pentakis(1H-pyrrole);quinazoline.
Molecular Properties
| Compound Name | pyridine;pentakis(1H-pyrrole);quinazoline |
| PubChem CID | 161401177 |
| Molecular Formula | C33H36N8 |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | pyridine;pentakis(1H-pyrrole);quinazoline |
| SMILES | c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.c1ccc2ncncc2c1.c1ccncc1 |
| InChI | InChI=1S/C8H6N2.C5H5N.5C4H5N/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-6-5-3-1;5*1-2-4-5-3-1/h1-6H;1-5H;5*1-5H |
| InChIKey | VUGKCTDZLXNPRV-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine;pentakis(1H-pyrrole);quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;pentakis(1H-pyrrole);quinazoline?
The IUPAC name of pyridine;pentakis(1H-pyrrole);quinazoline (CID 161401177) is pyridine;pentakis(1H-pyrrole);quinazoline.
What is the SMILES notation for pyridine;pentakis(1H-pyrrole);quinazoline?
The canonical SMILES for pyridine;pentakis(1H-pyrrole);quinazoline is c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.c1ccc2ncncc2c1.c1ccncc1.
What is the InChIKey of pyridine;pentakis(1H-pyrrole);quinazoline?
The InChIKey is VUGKCTDZLXNPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C5H5N.5C4H5N/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-4-6-5-3-1;5*1-2-4-5-3-1/h1-6H;1-5H;5*1-5H.
What are the key properties of pyridine;pentakis(1H-pyrrole);quinazoline?
pyridine;pentakis(1H-pyrrole);quinazoline has a molecular weight of 544.71 g/mol, XLogP of 7.78, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;pentakis(1H-pyrrole);quinazoline is sourced from PubChem (CID 161401177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).