About N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione (PubChem CID 161401430) has the molecular formula C10H20N4O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione.
Molecular Properties
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione |
| PubChem CID | 161401430 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione |
| SMILES | NCCNCCNCCN.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C6H18N4.C4H2O3/c7-1-3-9-5-6-10-4-2-8;5-3-1-2-4(6)7-3/h9-10H,1-8H2;1-2H |
| InChIKey | VUHCQBUAAGIIAE-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione?
The IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione (CID 161401430) is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione.
What is the SMILES notation for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione?
The canonical SMILES for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione is NCCNCCNCCN.O=C1C=CC(=O)O1.
What is the InChIKey of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione?
The InChIKey is VUHCQBUAAGIIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N4.C4H2O3/c7-1-3-9-5-6-10-4-2-8;5-3-1-2-4(6)7-3/h9-10H,1-8H2;1-2H.
What are the key properties of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione?
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione has a molecular weight of 244.29 g/mol, XLogP of -2.29, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;furan-2,5-dione is sourced from PubChem (CID 161401430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).