C31H48N12O2 — CID 161403115
N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methoxyphenyl]-N,N'-dimethylpentane-1,5-diamine;carbanide (PubChem CID 161403115) has the molecular formula C31H48N12O2 and a molecular weight of 620.81 g/mol. Its IUPAC name is N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methoxyphenyl]-N,N'-dimethylpentane-1,5-diamine;carbanide.
| Compound Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methoxyphenyl]-N,N'-dimethylpentane-1,5-diamine;carbanide |
|---|---|
| PubChem CID | 161403115 |
| Molecular Formula | C31H48N12O2 |
| Molecular Weight | 620.81 g/mol |
| Exact Mass | 620.40 |
| IUPAC Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methoxyphenyl]-N,N'-dimethylpentane-1,5-diamine;carbanide |
| SMILES | COc1cc(/N=N/c2n(C)nc[n+]2C)ccc1N(C)CCCCCN(C)c1ccc(/N=N/c2n(C)nc[n+]2C)cc1OC.[CH3-].[CH3-] |
| InChI | InChI=1S/C29H42N12O2.2CH3/c1-36(24-14-12-22(18-26(24)42-7)32-34-28-38(3)20-30-40(28)5)16-10-9-11-17-37(2)25-15-13-23(19-27(25)43-8)33-35-29-39(4)21-31-41(29)6;;/h12-15,18-21H,9-11,16-17H2,1-8H3;2*1H3/q+2;2*-1 |
| InChIKey | VUMLRLPXZGPOBS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 117.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.81 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|