About bromomethane;chloro-methyl-di(propan-2-yl)silane
bromomethane;chloro-methyl-di(propan-2-yl)silane (PubChem CID 161406053) has the molecular formula C8H20BrClSi
and a molecular weight of 259.69 g/mol. Its IUPAC name is bromomethane;chloro-methyl-di(propan-2-yl)silane.
Molecular Properties
| Compound Name | bromomethane;chloro-methyl-di(propan-2-yl)silane |
| PubChem CID | 161406053 |
| Molecular Formula | C8H20BrClSi |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | bromomethane;chloro-methyl-di(propan-2-yl)silane |
| SMILES | CBr.CC(C)[Si](C)(Cl)C(C)C |
| InChI | InChI=1S/C7H17ClSi.CH3Br/c1-6(2)9(5,8)7(3)4;1-2/h6-7H,1-5H3;1H3 |
| InChIKey | VUVVOQKSLPOILF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;chloro-methyl-di(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;chloro-methyl-di(propan-2-yl)silane?
The IUPAC name of bromomethane;chloro-methyl-di(propan-2-yl)silane (CID 161406053) is bromomethane;chloro-methyl-di(propan-2-yl)silane.
What is the SMILES notation for bromomethane;chloro-methyl-di(propan-2-yl)silane?
The canonical SMILES for bromomethane;chloro-methyl-di(propan-2-yl)silane is CBr.CC(C)[Si](C)(Cl)C(C)C.
What is the InChIKey of bromomethane;chloro-methyl-di(propan-2-yl)silane?
The InChIKey is VUVVOQKSLPOILF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17ClSi.CH3Br/c1-6(2)9(5,8)7(3)4;1-2/h6-7H,1-5H3;1H3.
What are the key properties of bromomethane;chloro-methyl-di(propan-2-yl)silane?
bromomethane;chloro-methyl-di(propan-2-yl)silane has a molecular weight of 259.69 g/mol, XLogP of 4.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;chloro-methyl-di(propan-2-yl)silane is sourced from PubChem (CID 161406053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).