C42H52O4 — CID 161406841
4-[4-(4-hydroxyphenyl)-4-methylcyclohexyl]-2,3-dimethylphenol (PubChem CID 161406841) has the molecular formula C42H52O4 and a molecular weight of 620.87 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)-4-methylcyclohexyl]-2,3-dimethylphenol.
| Compound Name | 4-[4-(4-hydroxyphenyl)-4-methylcyclohexyl]-2,3-dimethylphenol |
|---|---|
| PubChem CID | 161406841 |
| Molecular Formula | C42H52O4 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)-4-methylcyclohexyl]-2,3-dimethylphenol |
| SMILES | Cc1c(O)ccc(C2CCC(C)(c3ccc(O)cc3)CC2)c1C.Cc1c(O)ccc(C2CCC(C)(c3ccc(O)cc3)CC2)c1C |
| InChI | InChI=1S/2C21H26O2/c2*1-14-15(2)20(23)9-8-19(14)16-10-12-21(3,13-11-16)17-4-6-18(22)7-5-17/h2*4-9,16,22-23H,10-13H2,1-3H3 |
| InChIKey | VUYKMVHFESECRK-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |