C31H37N5O5 — CID 161407407
4-(4-benzhydrylpiperazin-1-yl)-1-[3-(2-methoxyethoxy)propyl]-3-nitro-4a,5-dihydro-1,5-naphthyridin-2-one (PubChem CID 161407407) has the molecular formula C31H37N5O5 and a molecular weight of 559.67 g/mol. Its IUPAC name is 4-(4-benzhydrylpiperazin-1-yl)-1-[3-(2-methoxyethoxy)propyl]-3-nitro-4a,5-dihydro-1,5-naphthyridin-2-one.
| Compound Name | 4-(4-benzhydrylpiperazin-1-yl)-1-[3-(2-methoxyethoxy)propyl]-3-nitro-4a,5-dihydro-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 161407407 |
| Molecular Formula | C31H37N5O5 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 4-(4-benzhydrylpiperazin-1-yl)-1-[3-(2-methoxyethoxy)propyl]-3-nitro-4a,5-dihydro-1,5-naphthyridin-2-one |
| SMILES | COCCOCCCN1C(=O)C([N+](=O)[O-])=C(N2CCN(C(c3ccccc3)c3ccccc3)CC2)C2NC=CC=C21 |
| InChI | InChI=1S/C31H37N5O5/c1-40-22-23-41-21-9-16-35-26-14-8-15-32-27(26)29(30(31(35)37)36(38)39)34-19-17-33(18-20-34)28(24-10-4-2-5-11-24)25-12-6-3-7-13-25/h2-8,10-15,27-28,32H,9,16-23H2,1H3 |
| InChIKey | VVAFAIYRLWPRPM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|