About bis(2,6-difluorophenol);zirconium
bis(2,6-difluorophenol);zirconium (PubChem CID 161409047) has the molecular formula C12H8F4O2Zr
and a molecular weight of 351.41 g/mol. Its IUPAC name is bis(2,6-difluorophenol);zirconium.
Molecular Properties
| Compound Name | bis(2,6-difluorophenol);zirconium |
| PubChem CID | 161409047 |
| Molecular Formula | C12H8F4O2Zr |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | bis(2,6-difluorophenol);zirconium |
| SMILES | Oc1c(F)cccc1F.Oc1c(F)cccc1F.[Zr] |
| InChI | InChI=1S/2C6H4F2O.Zr/c2*7-4-2-1-3-5(8)6(4)9;/h2*1-3,9H; |
| InChIKey | LLPINYNRQFYJCZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2,6-difluorophenol);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,6-difluorophenol);zirconium?
The IUPAC name of bis(2,6-difluorophenol);zirconium (CID 161409047) is bis(2,6-difluorophenol);zirconium.
What is the SMILES notation for bis(2,6-difluorophenol);zirconium?
The canonical SMILES for bis(2,6-difluorophenol);zirconium is Oc1c(F)cccc1F.Oc1c(F)cccc1F.[Zr].
What is the InChIKey of bis(2,6-difluorophenol);zirconium?
The InChIKey is LLPINYNRQFYJCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H4F2O.Zr/c2*7-4-2-1-3-5(8)6(4)9;/h2*1-3,9H;.
What are the key properties of bis(2,6-difluorophenol);zirconium?
bis(2,6-difluorophenol);zirconium has a molecular weight of 351.41 g/mol, XLogP of 3.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,6-difluorophenol);zirconium is sourced from PubChem (CID 161409047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).