C31H38F6N4O4 — CID 161410166
5,5-dimethyl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidine-2,4-dione;1-ethyl-5,5-dimethyl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidine-2,4-dione;propane (PubChem CID 161410166) has the molecular formula C31H38F6N4O4 and a molecular weight of 644.66 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidine-2,4-dione;1-ethyl-5,5-dimethyl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidine-2,4-dione;propane.
| Compound Name | 5,5-dimethyl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidine-2,4-dione;1-ethyl-5,5-dimethyl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidine-2,4-dione;propane |
|---|---|
| PubChem CID | 161410166 |
| Molecular Formula | C31H38F6N4O4 |
| Molecular Weight | 644.66 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 5,5-dimethyl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidine-2,4-dione;1-ethyl-5,5-dimethyl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidine-2,4-dione;propane |
| SMILES | CC1(C)NC(=O)N(c2ccc(CC(F)(F)F)cc2)C1=O.CCC.CCN1C(=O)N(c2ccc(CC(F)(F)F)cc2)C(=O)C1(C)C |
| InChI | InChI=1S/C15H17F3N2O2.C13H13F3N2O2.C3H8/c1-4-19-13(22)20(12(21)14(19,2)3)11-7-5-10(6-8-11)9-15(16,17)18;1-12(2)10(19)18(11(20)17-12)9-5-3-8(4-6-9)7-13(14,15)16;1-3-2/h5-8H,4,9H2,1-3H3;3-6H,7H2,1-2H3,(H,17,20);3H2,1-2H3 |
| InChIKey | VVIYKAPSLNHNGV-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|