About N-ethyl-2-methylprop-2-enamide;imidazol-2-one
N-ethyl-2-methylprop-2-enamide;imidazol-2-one (PubChem CID 161410420) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is N-ethyl-2-methylprop-2-enamide;imidazol-2-one.
Molecular Properties
| Compound Name | N-ethyl-2-methylprop-2-enamide;imidazol-2-one |
| PubChem CID | 161410420 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N-ethyl-2-methylprop-2-enamide;imidazol-2-one |
| SMILES | C=C(C)C(=O)NCC.O=C1N=CC=N1 |
| InChI | InChI=1S/C6H11NO.C3H2N2O/c1-4-7-6(8)5(2)3;6-3-4-1-2-5-3/h2,4H2,1,3H3,(H,7,8);1-2H |
| InChIKey | VVJWSKDGVSVXDB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-methylprop-2-enamide;imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methylprop-2-enamide;imidazol-2-one?
The IUPAC name of N-ethyl-2-methylprop-2-enamide;imidazol-2-one (CID 161410420) is N-ethyl-2-methylprop-2-enamide;imidazol-2-one.
What is the SMILES notation for N-ethyl-2-methylprop-2-enamide;imidazol-2-one?
The canonical SMILES for N-ethyl-2-methylprop-2-enamide;imidazol-2-one is C=C(C)C(=O)NCC.O=C1N=CC=N1.
What is the InChIKey of N-ethyl-2-methylprop-2-enamide;imidazol-2-one?
The InChIKey is VVJWSKDGVSVXDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C3H2N2O/c1-4-7-6(8)5(2)3;6-3-4-1-2-5-3/h2,4H2,1,3H3,(H,7,8);1-2H.
What are the key properties of N-ethyl-2-methylprop-2-enamide;imidazol-2-one?
N-ethyl-2-methylprop-2-enamide;imidazol-2-one has a molecular weight of 195.22 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methylprop-2-enamide;imidazol-2-one is sourced from PubChem (CID 161410420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).