C17H12BrF3N6O4 — CID 161410758
2-bromo-5-nitropyridin-4-amine;5-nitro-2-[2-(trifluoromethyl)phenyl]pyridin-4-amine (PubChem CID 161410758) has the molecular formula C17H12BrF3N6O4 and a molecular weight of 501.22 g/mol. Its IUPAC name is 2-bromo-5-nitropyridin-4-amine;5-nitro-2-[2-(trifluoromethyl)phenyl]pyridin-4-amine.
| Compound Name | 2-bromo-5-nitropyridin-4-amine;5-nitro-2-[2-(trifluoromethyl)phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 161410758 |
| Molecular Formula | C17H12BrF3N6O4 |
| Molecular Weight | 501.22 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | 2-bromo-5-nitropyridin-4-amine;5-nitro-2-[2-(trifluoromethyl)phenyl]pyridin-4-amine |
| SMILES | Nc1cc(-c2ccccc2C(F)(F)F)ncc1[N+](=O)[O-].Nc1cc(Br)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8F3N3O2.C5H4BrN3O2/c13-12(14,15)8-4-2-1-3-7(8)10-5-9(16)11(6-17-10)18(19)20;6-5-1-3(7)4(2-8-5)9(10)11/h1-6H,(H2,16,17);1-2H,(H2,7,8) |
| InChIKey | VVKXVSOTTAMTDH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 164.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|