C14H25NO2SSi — CID 161411518
N,N-diethyl-4-(propylsilylmethylsulfonyl)aniline (PubChem CID 161411518) has the molecular formula C14H25NO2SSi and a molecular weight of 299.51 g/mol. Its IUPAC name is N,N-diethyl-4-(propylsilylmethylsulfonyl)aniline.
| Compound Name | N,N-diethyl-4-(propylsilylmethylsulfonyl)aniline |
|---|---|
| PubChem CID | 161411518 |
| Molecular Formula | C14H25NO2SSi |
| Molecular Weight | 299.51 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N,N-diethyl-4-(propylsilylmethylsulfonyl)aniline |
| SMILES | CCC[SiH2]CS(=O)(=O)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C14H25NO2SSi/c1-4-11-19-12-18(16,17)14-9-7-13(8-10-14)15(5-2)6-3/h7-10H,4-6,11-12,19H2,1-3H3 |
| InChIKey | RXUPNRCUCOJCDL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|