About 3-chloro-4-fluoroaniline;2,4-difluoroaniline
3-chloro-4-fluoroaniline;2,4-difluoroaniline (PubChem CID 161411905) has the molecular formula C12H10ClF3N2
and a molecular weight of 274.67 g/mol. Its IUPAC name is 3-chloro-4-fluoroaniline;2,4-difluoroaniline.
Molecular Properties
| Compound Name | 3-chloro-4-fluoroaniline;2,4-difluoroaniline |
| PubChem CID | 161411905 |
| Molecular Formula | C12H10ClF3N2 |
| Molecular Weight | 274.67 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 3-chloro-4-fluoroaniline;2,4-difluoroaniline |
| SMILES | Nc1ccc(F)c(Cl)c1.Nc1ccc(F)cc1F |
| InChI | InChI=1S/C6H5ClFN.C6H5F2N/c7-5-3-4(9)1-2-6(5)8;7-4-1-2-6(9)5(8)3-4/h2*1-3H,9H2 |
| InChIKey | VVORPCGENGDPDW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-fluoroaniline;2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-fluoroaniline;2,4-difluoroaniline?
The IUPAC name of 3-chloro-4-fluoroaniline;2,4-difluoroaniline (CID 161411905) is 3-chloro-4-fluoroaniline;2,4-difluoroaniline.
What is the SMILES notation for 3-chloro-4-fluoroaniline;2,4-difluoroaniline?
The canonical SMILES for 3-chloro-4-fluoroaniline;2,4-difluoroaniline is Nc1ccc(F)c(Cl)c1.Nc1ccc(F)cc1F.
What is the InChIKey of 3-chloro-4-fluoroaniline;2,4-difluoroaniline?
The InChIKey is VVORPCGENGDPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClFN.C6H5F2N/c7-5-3-4(9)1-2-6(5)8;7-4-1-2-6(9)5(8)3-4/h2*1-3H,9H2.
What are the key properties of 3-chloro-4-fluoroaniline;2,4-difluoroaniline?
3-chloro-4-fluoroaniline;2,4-difluoroaniline has a molecular weight of 274.67 g/mol, XLogP of 3.61, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-fluoroaniline;2,4-difluoroaniline is sourced from PubChem (CID 161411905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).