C25H31N3O2S — CID 161412061
4-anilino-N-tert-butyl-6-(2-propylsulfinylethyl)quinoline-3-carboxamide (PubChem CID 161412061) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is 4-anilino-N-tert-butyl-6-(2-propylsulfinylethyl)quinoline-3-carboxamide.
| Compound Name | 4-anilino-N-tert-butyl-6-(2-propylsulfinylethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 161412061 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 4-anilino-N-tert-butyl-6-(2-propylsulfinylethyl)quinoline-3-carboxamide |
| SMILES | CCCS(=O)CCc1ccc2ncc(C(=O)NC(C)(C)C)c(Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C25H31N3O2S/c1-5-14-31(30)15-13-18-11-12-22-20(16-18)23(27-19-9-7-6-8-10-19)21(17-26-22)24(29)28-25(2,3)4/h6-12,16-17H,5,13-15H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | SBEGRAJNYFZUQW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |