C28H23ClF3N5O7S — CID 161412844
methyl 4-chloro-3-nitrobenzoate;methyl 1-propan-2-yl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate (PubChem CID 161412844) has the molecular formula C28H23ClF3N5O7S and a molecular weight of 666.03 g/mol. Its IUPAC name is methyl 4-chloro-3-nitrobenzoate;methyl 1-propan-2-yl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate.
| Compound Name | methyl 4-chloro-3-nitrobenzoate;methyl 1-propan-2-yl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 161412844 |
| Molecular Formula | C28H23ClF3N5O7S |
| Molecular Weight | 666.03 g/mol |
| Exact Mass | 665.10 |
| IUPAC Name | methyl 4-chloro-3-nitrobenzoate;methyl 1-propan-2-yl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)c([N+](=O)[O-])c1.COC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(OC(F)(F)F)cc3s1)n2C(C)C |
| InChI | InChI=1S/C20H17F3N4O3S.C8H6ClNO4/c1-10(2)27-15-7-4-11(17(28)29-3)8-14(15)24-18(27)26-19-25-13-6-5-12(9-16(13)31-19)30-20(21,22)23;1-14-8(11)5-2-3-6(9)7(4-5)10(12)13/h4-10H,1-3H3,(H,24,25,26);2-4H,1H3 |
| InChIKey | VVRYDGLHOMQZEI-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.03 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|