About 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane
4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane (PubChem CID 161413068) has the molecular formula C18H31NO2
and a molecular weight of 293.45 g/mol. Its IUPAC name is 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane.
Molecular Properties
| Compound Name | 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane |
| PubChem CID | 161413068 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane |
| SMILES | C.Cc1cc(C(C)(C)C)co1.Cc1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C9H14O.C8H13NO.CH4/c1-7-5-8(6-10-7)9(2,3)4;1-6-5-7(10-9-6)8(2,3)4;/h5-6H,1-4H3;5H,1-4H3;1H4 |
| InChIKey | VVSQJUJSWIUWGV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane?
The IUPAC name of 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane (CID 161413068) is 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane.
What is the SMILES notation for 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane?
The canonical SMILES for 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane is C.Cc1cc(C(C)(C)C)co1.Cc1cc(C(C)(C)C)on1.
What is the InChIKey of 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane?
The InChIKey is VVSQJUJSWIUWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.C8H13NO.CH4/c1-7-5-8(6-10-7)9(2,3)4;1-6-5-7(10-9-6)8(2,3)4;/h5-6H,1-4H3;5H,1-4H3;1H4.
What are the key properties of 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane?
4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane has a molecular weight of 293.45 g/mol, XLogP of 5.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-methylfuran;5-tert-butyl-3-methyl-1,2-oxazole;methane is sourced from PubChem (CID 161413068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).