C30H24ClFN2O5 — CID 161413932
4-[2-chloro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 161413932) has the molecular formula C30H24ClFN2O5 and a molecular weight of 546.98 g/mol. Its IUPAC name is 4-[2-chloro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[2-chloro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 161413932 |
| Molecular Formula | C30H24ClFN2O5 |
| Molecular Weight | 546.98 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 4-[2-chloro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3Cl)c2cc1C(N)=O |
| InChI | InChI=1S/C30H24ClFN2O5/c1-38-26-16-23-20(15-21(26)29(33)37)24(8-11-34-23)39-25-7-4-18(12-22(25)31)14-28(36)30(9-10-30)27(35)13-17-2-5-19(32)6-3-17/h2-8,11-12,15-16H,9-10,13-14H2,1H3,(H2,33,37) |
| InChIKey | VVVGLPUVVXGZMQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.98 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|