C25H27N3O6S3 — CID 161414563
3-benzyl-6-hydroxy-5-[7-(2-methylsulfonylethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-azatricyclo[6.2.1.02,7]undec-5-en-4-one (PubChem CID 161414563) has the molecular formula C25H27N3O6S3 and a molecular weight of 561.71 g/mol. Its IUPAC name is 3-benzyl-6-hydroxy-5-[7-(2-methylsulfonylethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-azatricyclo[6.2.1.02,7]undec-5-en-4-one.
| Compound Name | 3-benzyl-6-hydroxy-5-[7-(2-methylsulfonylethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-azatricyclo[6.2.1.02,7]undec-5-en-4-one |
|---|---|
| PubChem CID | 161414563 |
| Molecular Formula | C25H27N3O6S3 |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | 3-benzyl-6-hydroxy-5-[7-(2-methylsulfonylethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-azatricyclo[6.2.1.02,7]undec-5-en-4-one |
| SMILES | CS(=O)(=O)CCc1csc2c1S(=O)(=O)N=C(C1=C(O)C3C4CCC(C4)C3N(Cc3ccccc3)C1=O)N2 |
| InChI | InChI=1S/C25H27N3O6S3/c1-36(31,32)10-9-17-13-35-24-22(17)37(33,34)27-23(26-24)19-21(29)18-15-7-8-16(11-15)20(18)28(25(19)30)12-14-5-3-2-4-6-14/h2-6,13,15-16,18,20,29H,7-12H2,1H3,(H,26,27) |
| InChIKey | VVXGXUMUWDTACR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |