bromobenzene;2-methylpropanoic acid

C10H13BrO2 — CID 161414632

IUPACbromobenzene;2-methylpropanoic acid
SMILESBrc1ccccc1.CC(C)C(=O)O
InChIInChI=1S/C6H5Br.C4H8O2/c7-6-4-2-1-3-5-6;1-3(2)4(5)6/h1-5H;3H,1-2H3,(H,5,6)
InChIKeyVVXMGBQIGHOWFC-UHFFFAOYSA-N
MW245.12 g/mol
LogP3.18
Rot. Bonds1

About bromobenzene;2-methylpropanoic acid

bromobenzene;2-methylpropanoic acid (PubChem CID 161414632) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is bromobenzene;2-methylpropanoic acid.

Molecular Properties

Compound Namebromobenzene;2-methylpropanoic acid
PubChem CID161414632
Molecular FormulaC10H13BrO2
Molecular Weight245.12 g/mol
Exact Mass244.01
IUPAC Namebromobenzene;2-methylpropanoic acid
SMILESBrc1ccccc1.CC(C)C(=O)O
InChIInChI=1S/C6H5Br.C4H8O2/c7-6-4-2-1-3-5-6;1-3(2)4(5)6/h1-5H;3H,1-2H3,(H,5,6)
InChIKeyVVXMGBQIGHOWFC-UHFFFAOYSA-N
XLogP3.18
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.12
LogP ≤ 53.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze bromobenzene;2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bromobenzene;2-methylpropanoic acid?
The IUPAC name of bromobenzene;2-methylpropanoic acid (CID 161414632) is bromobenzene;2-methylpropanoic acid.
What is the SMILES notation for bromobenzene;2-methylpropanoic acid?
The canonical SMILES for bromobenzene;2-methylpropanoic acid is Brc1ccccc1.CC(C)C(=O)O.
What is the InChIKey of bromobenzene;2-methylpropanoic acid?
The InChIKey is VVXMGBQIGHOWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br.C4H8O2/c7-6-4-2-1-3-5-6;1-3(2)4(5)6/h1-5H;3H,1-2H3,(H,5,6).
What are the key properties of bromobenzene;2-methylpropanoic acid?
bromobenzene;2-methylpropanoic acid has a molecular weight of 245.12 g/mol, XLogP of 3.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;2-methylpropanoic acid is sourced from PubChem (CID 161414632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).