C30H22N6 — CID 161415340
7,8,14,19,25,26-hexamethyl-9,11,13,20,22,24-hexazanonacyclo[16.12.0.02,15.03,12.04,29.05,10.06,27.021,30.023,28]triaconta-1(30),2,4,6,8,10,12,15,17,20,22,24,26,28-tetradecaene (PubChem CID 161415340) has the molecular formula C30H22N6 and a molecular weight of 466.55 g/mol. Its IUPAC name is 7,8,14,19,25,26-hexamethyl-9,11,13,20,22,24-hexazanonacyclo[16.12.0.02,15.03,12.04,29.05,10.06,27.021,30.023,28]triaconta-1(30),2,4,6,8,10,12,15,17,20,22,24,26,28-tetradecaene.
| Compound Name | 7,8,14,19,25,26-hexamethyl-9,11,13,20,22,24-hexazanonacyclo[16.12.0.02,15.03,12.04,29.05,10.06,27.021,30.023,28]triaconta-1(30),2,4,6,8,10,12,15,17,20,22,24,26,28-tetradecaene |
|---|---|
| PubChem CID | 161415340 |
| Molecular Formula | C30H22N6 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 7,8,14,19,25,26-hexamethyl-9,11,13,20,22,24-hexazanonacyclo[16.12.0.02,15.03,12.04,29.05,10.06,27.021,30.023,28]triaconta-1(30),2,4,6,8,10,12,15,17,20,22,24,26,28-tetradecaene |
| SMILES | Cc1nc2nc3c4c5c(ccc6c5c5c(nc7nc(C)c(C)c8c(c1C)c2c4c5c78)=NC6C)C(C)N=3 |
| InChI | InChI=1S/C30H22N6/c1-9-11(3)31-27-23-17(9)18-10(2)12(4)32-28-24(18)22-21(23)25-19-15(13(5)33-29(25)35-27)7-8-16-14(6)34-30(36-28)26(22)20(16)19/h7-8,13-14H,1-6H3 |
| InChIKey | LGXTZKMBOQNXEC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 76.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|