About cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol
cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol (PubChem CID 161415382) has the molecular formula C18H34N2O3
and a molecular weight of 326.48 g/mol. Its IUPAC name is cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol.
Molecular Properties
| Compound Name | cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol |
| PubChem CID | 161415382 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol |
| SMILES | O=C1CCC1.OC1CCN(C2CCC2)CC1.OC1CCNCC1 |
| InChI | InChI=1S/C9H17NO.C5H11NO.C4H6O/c11-9-4-6-10(7-5-9)8-2-1-3-8;7-5-1-3-6-4-2-5;5-4-2-1-3-4/h8-9,11H,1-7H2;5-7H,1-4H2;1-3H2 |
| InChIKey | VWACAAGEQJEYII-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol?
The IUPAC name of cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol (CID 161415382) is cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol.
What is the SMILES notation for cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol?
The canonical SMILES for cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol is O=C1CCC1.OC1CCN(C2CCC2)CC1.OC1CCNCC1.
What is the InChIKey of cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol?
The InChIKey is VWACAAGEQJEYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C5H11NO.C4H6O/c11-9-4-6-10(7-5-9)8-2-1-3-8;7-5-1-3-6-4-2-5;5-4-2-1-3-4/h8-9,11H,1-7H2;5-7H,1-4H2;1-3H2.
What are the key properties of cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol?
cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol has a molecular weight of 326.48 g/mol, XLogP of 1.47, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutanone;1-cyclobutylpiperidin-4-ol;piperidin-4-ol is sourced from PubChem (CID 161415382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).