About 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite
4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite (PubChem CID 161415596) has the molecular formula C12H26F2O2
and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite.
Molecular Properties
| Compound Name | 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite |
| PubChem CID | 161415596 |
| Molecular Formula | C12H26F2O2 |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite |
| SMILES | C.C.CCCOF.O=C1CCC(CF)CC1 |
| InChI | InChI=1S/C7H11FO.C3H7FO.2CH4/c8-5-6-1-3-7(9)4-2-6;1-2-3-5-4;;/h6H,1-5H2;2-3H2,1H3;2*1H4 |
| InChIKey | VWASOCIPTMOAPU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite?
The IUPAC name of 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite (CID 161415596) is 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite.
What is the SMILES notation for 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite?
The canonical SMILES for 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite is C.C.CCCOF.O=C1CCC(CF)CC1.
What is the InChIKey of 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite?
The InChIKey is VWASOCIPTMOAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FO.C3H7FO.2CH4/c8-5-6-1-3-7(9)4-2-6;1-2-3-5-4;;/h6H,1-5H2;2-3H2,1H3;2*1H4.
What are the key properties of 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite?
4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite has a molecular weight of 240.33 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(fluoromethyl)cyclohexan-1-one;methane;propyl hypofluorite is sourced from PubChem (CID 161415596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).