About 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane
3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane (PubChem CID 161415619) has the molecular formula C25H49N
and a molecular weight of 363.67 g/mol. Its IUPAC name is 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane.
Molecular Properties
| Compound Name | 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane |
| PubChem CID | 161415619 |
| Molecular Formula | C25H49N |
| Molecular Weight | 363.67 g/mol |
| Exact Mass | 363.39 |
| IUPAC Name | 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane |
| SMILES | C.CC(C)(C)C1CC2CCC(C2)C1.CC(C)(C)CC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C12H23N.C12H22.CH4/c1-12(2,3)8-9-6-10-4-5-11(7-9)13-10;1-12(2,3)11-7-9-4-5-10(6-9)8-11;/h9-11,13H,4-8H2,1-3H3;9-11H,4-8H2,1-3H3;1H4 |
| InChIKey | VWAVKQZPCFJQJX-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.67 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane?
The IUPAC name of 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane (CID 161415619) is 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane.
What is the SMILES notation for 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane?
The canonical SMILES for 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane is C.CC(C)(C)C1CC2CCC(C2)C1.CC(C)(C)CC1CC2CCC(C1)N2.
What is the InChIKey of 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane?
The InChIKey is VWAVKQZPCFJQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C12H22.CH4/c1-12(2,3)8-9-6-10-4-5-11(7-9)13-10;1-12(2,3)11-7-9-4-5-10(6-9)8-11;/h9-11,13H,4-8H2,1-3H3;9-11H,4-8H2,1-3H3;1H4.
What are the key properties of 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane?
3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane has a molecular weight of 363.67 g/mol, XLogP of 7.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butylbicyclo[3.2.1]octane;3-(2,2-dimethylpropyl)-8-azabicyclo[3.2.1]octane;methane is sourced from PubChem (CID 161415619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).