C17H23F3N4O4 — CID 161415881
tert-butyl 6-[4-nitro-3-(3,3,3-trifluoropropyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 161415881) has the molecular formula C17H23F3N4O4 and a molecular weight of 404.39 g/mol. Its IUPAC name is tert-butyl 6-[4-nitro-3-(3,3,3-trifluoropropyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[4-nitro-3-(3,3,3-trifluoropropyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 161415881 |
| Molecular Formula | C17H23F3N4O4 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | tert-butyl 6-[4-nitro-3-(3,3,3-trifluoropropyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(n3cc([N+](=O)[O-])c(CCC(F)(F)F)n3)C2)C1 |
| InChI | InChI=1S/C17H23F3N4O4/c1-15(2,3)28-14(25)22-9-16(10-22)6-11(7-16)23-8-13(24(26)27)12(21-23)4-5-17(18,19)20/h8,11H,4-7,9-10H2,1-3H3 |
| InChIKey | VWBRRSNTHQMFFT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|