About N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride
N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride (PubChem CID 161416921) has the molecular formula C16H18ClN3O8S2
and a molecular weight of 479.92 g/mol. Its IUPAC name is N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride.
Molecular Properties
| Compound Name | N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride |
| PubChem CID | 161416921 |
| Molecular Formula | C16H18ClN3O8S2 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride |
| SMILES | CC(C)N(C)S(=O)(=O)c1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H14N2O4S.C6H4ClNO4S/c1-8(2)11(3)17(15,16)10-7-5-4-6-9(10)12(13)14;7-13(11,12)6-4-2-1-3-5(6)8(9)10/h4-8H,1-3H3;1-4H |
| InChIKey | VWEYZNQOTHYHAR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride?
The IUPAC name of N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride (CID 161416921) is N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride.
What is the SMILES notation for N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride?
The canonical SMILES for N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride is CC(C)N(C)S(=O)(=O)c1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1S(=O)(=O)Cl.
What is the InChIKey of N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride?
The InChIKey is VWEYZNQOTHYHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4S.C6H4ClNO4S/c1-8(2)11(3)17(15,16)10-7-5-4-6-9(10)12(13)14;7-13(11,12)6-4-2-1-3-5(6)8(9)10/h4-8H,1-3H3;1-4H.
What are the key properties of N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride?
N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride has a molecular weight of 479.92 g/mol, XLogP of 3.15, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-nitro-N-propan-2-ylbenzenesulfonamide;2-nitrobenzenesulfonyl chloride is sourced from PubChem (CID 161416921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).