About 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide
2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide (PubChem CID 161417346) has the molecular formula C6H13BrN2
and a molecular weight of 193.09 g/mol. Its IUPAC name is 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide.
Molecular Properties
| Compound Name | 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide |
| PubChem CID | 161417346 |
| Molecular Formula | C6H13BrN2 |
| Molecular Weight | 193.09 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide |
| SMILES | C[N+]1(C)CC=CCN1.[Br-] |
| InChI | InChI=1S/C6H13N2.BrH/c1-8(2)6-4-3-5-7-8;/h3-4,7H,5-6H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | VWGJUDJDLVDYON-UHFFFAOYSA-M |
| XLogP | -2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.09 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide?
The IUPAC name of 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide (CID 161417346) is 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide.
What is the SMILES notation for 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide?
The canonical SMILES for 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide is C[N+]1(C)CC=CCN1.[Br-].
What is the InChIKey of 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide?
The InChIKey is VWGJUDJDLVDYON-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H13N2.BrH/c1-8(2)6-4-3-5-7-8;/h3-4,7H,5-6H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide?
2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide has a molecular weight of 193.09 g/mol, XLogP of -2.86, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3,6-dihydro-1H-pyridazin-2-ium bromide is sourced from PubChem (CID 161417346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).