C20H23N7 — CID 161419974
1-propyl-1,2,3,3-tetra(pyrrol-1-yl)guanidine (PubChem CID 161419974) has the molecular formula C20H23N7 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-propyl-1,2,3,3-tetra(pyrrol-1-yl)guanidine.
| Compound Name | 1-propyl-1,2,3,3-tetra(pyrrol-1-yl)guanidine |
|---|---|
| PubChem CID | 161419974 |
| Molecular Formula | C20H23N7 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 1-propyl-1,2,3,3-tetra(pyrrol-1-yl)guanidine |
| SMILES | CCCN(C(=Nn1cccc1)N(n1cccc1)n1cccc1)n1cccc1 |
| InChI | InChI=1S/C20H23N7/c1-2-11-26(23-14-5-6-15-23)20(21-22-12-3-4-13-22)27(24-16-7-8-17-24)25-18-9-10-19-25/h3-10,12-19H,2,11H2,1H3 |
| InChIKey | VWPFPIWBRUEPOI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|