C25H34N2O4 — CID 161420782
1-[4-[3-[(3R)-3-aminopyrrolidin-1-yl]propoxy]phenyl]propan-1-one;1-(4-hydroxyphenyl)propan-1-one (PubChem CID 161420782) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 1-[4-[3-[(3R)-3-aminopyrrolidin-1-yl]propoxy]phenyl]propan-1-one;1-(4-hydroxyphenyl)propan-1-one.
| Compound Name | 1-[4-[3-[(3R)-3-aminopyrrolidin-1-yl]propoxy]phenyl]propan-1-one;1-(4-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 161420782 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 1-[4-[3-[(3R)-3-aminopyrrolidin-1-yl]propoxy]phenyl]propan-1-one;1-(4-hydroxyphenyl)propan-1-one |
| SMILES | CCC(=O)c1ccc(O)cc1.CCC(=O)c1ccc(OCCCN2CC[C@@H](N)C2)cc1 |
| InChI | InChI=1S/C16H24N2O2.C9H10O2/c1-2-16(19)13-4-6-15(7-5-13)20-11-3-9-18-10-8-14(17)12-18;1-2-9(11)7-3-5-8(10)6-4-7/h4-7,14H,2-3,8-12,17H2,1H3;3-6,10H,2H2,1H3/t14-;/m1./s1 |
| InChIKey | VWSAHXNULMCWSF-PFEQFJNWSA-N |
| XLogP | 4.07 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|