C51H68O — CID 161421133
7-(3,5-ditert-butylphenyl)-2,5-dimethyl-1H-indene;4-(3,5-ditert-butylphenyl)-1-methoxy-2,6-dimethyl-2,3-dihydro-1H-indene (PubChem CID 161421133) has the molecular formula C51H68O and a molecular weight of 697.10 g/mol. Its IUPAC name is 7-(3,5-ditert-butylphenyl)-2,5-dimethyl-1H-indene;4-(3,5-ditert-butylphenyl)-1-methoxy-2,6-dimethyl-2,3-dihydro-1H-indene.
| Compound Name | 7-(3,5-ditert-butylphenyl)-2,5-dimethyl-1H-indene;4-(3,5-ditert-butylphenyl)-1-methoxy-2,6-dimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 161421133 |
| Molecular Formula | C51H68O |
| Molecular Weight | 697.10 g/mol |
| Exact Mass | 696.53 |
| IUPAC Name | 7-(3,5-ditert-butylphenyl)-2,5-dimethyl-1H-indene;4-(3,5-ditert-butylphenyl)-1-methoxy-2,6-dimethyl-2,3-dihydro-1H-indene |
| SMILES | CC1=Cc2cc(C)cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2C1.COC1c2cc(C)cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2CC1C |
| InChI | InChI=1S/C26H36O.C25H32/c1-16-10-21(22-12-17(2)24(27-9)23(22)11-16)18-13-19(25(3,4)5)15-20(14-18)26(6,7)8;1-16-9-18-10-17(2)12-23(22(18)11-16)19-13-20(24(3,4)5)15-21(14-19)25(6,7)8/h10-11,13-15,17,24H,12H2,1-9H3;9-10,12-15H,11H2,1-8H3 |
| InChIKey | VWTCWXWSHQMLSQ-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.10 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |