C22H15Cl2N5O3 — CID 161423027
5-[3-(5-cyano-2-pyridinyl)propoxy]-7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidine-2-carboxylic acid (PubChem CID 161423027) has the molecular formula C22H15Cl2N5O3 and a molecular weight of 468.30 g/mol. Its IUPAC name is 5-[3-(5-cyano-2-pyridinyl)propoxy]-7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidine-2-carboxylic acid.
| Compound Name | 5-[3-(5-cyano-2-pyridinyl)propoxy]-7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 161423027 |
| Molecular Formula | C22H15Cl2N5O3 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 5-[3-(5-cyano-2-pyridinyl)propoxy]-7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidine-2-carboxylic acid |
| SMILES | N#Cc1ccc(CCCOc2nc(-c3ccc(Cl)cc3Cl)cc3nc(C(=O)O)cn23)nc1 |
| InChI | InChI=1S/C22H15Cl2N5O3/c23-14-4-6-16(17(24)8-14)18-9-20-27-19(21(30)31)12-29(20)22(28-18)32-7-1-2-15-5-3-13(10-25)11-26-15/h3-6,8-9,11-12H,1-2,7H2,(H,30,31) |
| InChIKey | VWZJWJAEZGYJDJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|