C19H30O11 — CID 161423055
bis(carbon dioxide);methyl (6R,7R)-1-heptyl-4,6,7-trihydroxy-4,5-dimethyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 161423055) has the molecular formula C19H30O11 and a molecular weight of 434.44 g/mol. Its IUPAC name is bis(carbon dioxide);methyl (6R,7R)-1-heptyl-4,6,7-trihydroxy-4,5-dimethyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | bis(carbon dioxide);methyl (6R,7R)-1-heptyl-4,6,7-trihydroxy-4,5-dimethyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 161423055 |
| Molecular Formula | C19H30O11 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | bis(carbon dioxide);methyl (6R,7R)-1-heptyl-4,6,7-trihydroxy-4,5-dimethyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CCCCCCCC12OC(C(=O)OC)C(C)(O)C(C)(O1)[C@H](O)[C@H]2O.O=C=O.O=C=O |
| InChI | InChI=1S/C17H30O7.2CO2/c1-5-6-7-8-9-10-17-12(19)11(18)16(3,24-17)15(2,21)13(23-17)14(20)22-4;2*2-1-3/h11-13,18-19,21H,5-10H2,1-4H3;;/t11-,12-,13?,15?,16?,17?;;/m1../s1 |
| InChIKey | VWZLULMNQZJEIO-VFZPQVJGSA-N |
| XLogP | -0.29 |
| TPSA | 173.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|