C26H36ClNO2 — CID 161425104
[3-[(1Z,3E,5E,7E)-deca-1,3,5,7,9-pentaenoxy]-2-[(3E,5E,7E)-deca-1,3,5,7,9-pentaen-2-yl]oxypropyl]-trimethylazanium chloride (PubChem CID 161425104) has the molecular formula C26H36ClNO2 and a molecular weight of 430.03 g/mol. Its IUPAC name is [3-[(1Z,3E,5E,7E)-deca-1,3,5,7,9-pentaenoxy]-2-[(3E,5E,7E)-deca-1,3,5,7,9-pentaen-2-yl]oxypropyl]-trimethylazanium chloride.
| Compound Name | [3-[(1Z,3E,5E,7E)-deca-1,3,5,7,9-pentaenoxy]-2-[(3E,5E,7E)-deca-1,3,5,7,9-pentaen-2-yl]oxypropyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 161425104 |
| Molecular Formula | C26H36ClNO2 |
| Molecular Weight | 430.03 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | [3-[(1Z,3E,5E,7E)-deca-1,3,5,7,9-pentaenoxy]-2-[(3E,5E,7E)-deca-1,3,5,7,9-pentaen-2-yl]oxypropyl]-trimethylazanium chloride |
| SMILES | C=C/C=C/C=C/C=C/C=C\OCC(C[N+](C)(C)C)OC(=C)/C=C/C=C/C=C/C=C.[Cl-] |
| InChI | InChI=1S/C26H36NO2.ClH/c1-7-9-11-13-15-16-18-20-22-28-24-26(23-27(4,5)6)29-25(3)21-19-17-14-12-10-8-2;/h7-22,26H,1-3,23-24H2,4-6H3;1H/q+1;/p-1/b11-9+,12-10+,15-13+,17-14+,18-16+,21-19+,22-20-; |
| InChIKey | ROPWMVOPYSHUDF-DQOUEJILSA-M |
| XLogP | 2.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.03 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|