About 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide
5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide (PubChem CID 161425189) has the molecular formula C11H19F3N3O2S+
and a molecular weight of 314.35 g/mol. Its IUPAC name is 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide |
| PubChem CID | 161425189 |
| Molecular Formula | C11H19F3N3O2S+ |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide |
| SMILES | C1CC[N+]2(CC1)CCCC2.N#CNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H18N.C2HF3N2O2S/c1-2-6-10(7-3-1)8-4-5-9-10;3-2(4,5)10(8,9)7-1-6/h1-9H2;7H/q+1; |
| InChIKey | BMEMRUGXKXVNOP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide?
The IUPAC name of 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide (CID 161425189) is 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide.
What is the SMILES notation for 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide?
The canonical SMILES for 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide is C1CC[N+]2(CC1)CCCC2.N#CNS(=O)(=O)C(F)(F)F.
What is the InChIKey of 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide?
The InChIKey is BMEMRUGXKXVNOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N.C2HF3N2O2S/c1-2-6-10(7-3-1)8-4-5-9-10;3-2(4,5)10(8,9)7-1-6/h1-9H2;7H/q+1;.
What are the key properties of 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide?
5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide has a molecular weight of 314.35 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azoniaspiro[4.5]decane;N-cyano-1,1,1-trifluoromethanesulfonamide is sourced from PubChem (CID 161425189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).