About 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene
1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene (PubChem CID 161428057) has the molecular formula C27H17I4NO
and a molecular weight of 879.05 g/mol. Its IUPAC name is 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene.
Molecular Properties
| Compound Name | 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene |
| PubChem CID | 161428057 |
| Molecular Formula | C27H17I4NO |
| Molecular Weight | 879.05 g/mol |
| Exact Mass | 878.75 |
| IUPAC Name | 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene |
| SMILES | CC(=O)n1c2ccc(I)cc2c2cc(I)ccc21.Ic1ccc2c(c1)-c1cc(I)ccc1C2 |
| InChI | InChI=1S/C14H9I2NO.C13H8I2/c1-8(18)17-13-4-2-9(15)6-11(13)12-7-10(16)3-5-14(12)17;14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10/h2-7H,1H3;1-4,6-7H,5H2 |
| InChIKey | VXQDQIWRLZTAPE-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 879.05 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene?
The IUPAC name of 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene (CID 161428057) is 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene.
What is the SMILES notation for 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene?
The canonical SMILES for 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene is CC(=O)n1c2ccc(I)cc2c2cc(I)ccc21.Ic1ccc2c(c1)-c1cc(I)ccc1C2.
What is the InChIKey of 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene?
The InChIKey is VXQDQIWRLZTAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9I2NO.C13H8I2/c1-8(18)17-13-4-2-9(15)6-11(13)12-7-10(16)3-5-14(12)17;14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10/h2-7H,1H3;1-4,6-7H,5H2.
What are the key properties of 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene?
1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene has a molecular weight of 879.05 g/mol, XLogP of 9.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-diiodocarbazol-9-yl)ethanone;3,6-diiodo-9H-fluorene is sourced from PubChem (CID 161428057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).