About bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+)
bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+) (PubChem CID 161430637) has the molecular formula C30H20F2Ti
and a molecular weight of 466.35 g/mol. Its IUPAC name is bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+).
Molecular Properties
| Compound Name | bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+) |
| PubChem CID | 161430637 |
| Molecular Formula | C30H20F2Ti |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+) |
| SMILES | Fc1ccc(-c2cc3ccccc3[cH-]2)cc1.Fc1ccc(-c2cc3ccccc3[cH-]2)cc1.[Ti+2] |
| InChI | InChI=1S/2C15H10F.Ti/c2*16-15-7-5-11(6-8-15)14-9-12-3-1-2-4-13(12)10-14;/h2*1-10H;/q2*-1;+2 |
| InChIKey | VXYPIJBIKXBCAL-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+)?
The IUPAC name of bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+) (CID 161430637) is bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+).
What is the SMILES notation for bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+)?
The canonical SMILES for bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+) is Fc1ccc(-c2cc3ccccc3[cH-]2)cc1.Fc1ccc(-c2cc3ccccc3[cH-]2)cc1.[Ti+2].
What is the InChIKey of bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+)?
The InChIKey is VXYPIJBIKXBCAL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H10F.Ti/c2*16-15-7-5-11(6-8-15)14-9-12-3-1-2-4-13(12)10-14;/h2*1-10H;/q2*-1;+2.
What are the key properties of bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+)?
bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+) has a molecular weight of 466.35 g/mol, XLogP of 8.73, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(4-fluorophenyl)-1H-inden-1-ide);titanium(2+) is sourced from PubChem (CID 161430637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).