About copper;1H-imidazole;sulfate
copper;1H-imidazole;sulfate (PubChem CID 161432361) has the molecular formula C3H4CuN2O4S
and a molecular weight of 227.69 g/mol. Its IUPAC name is copper;1H-imidazole;sulfate.
Molecular Properties
| Compound Name | copper;1H-imidazole;sulfate |
| PubChem CID | 161432361 |
| Molecular Formula | C3H4CuN2O4S |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 226.92 |
| IUPAC Name | copper;1H-imidazole;sulfate |
| SMILES | O=S(=O)([O-])[O-].[Cu+2].c1c[nH]cn1 |
| InChI | InChI=1S/C3H4N2.Cu.H2O4S/c1-2-5-3-4-1;;1-5(2,3)4/h1-3H,(H,4,5);;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | VYEOSHCSDHRUAB-UHFFFAOYSA-L |
| XLogP | -0.93 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze copper;1H-imidazole;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1H-imidazole;sulfate?
The IUPAC name of copper;1H-imidazole;sulfate (CID 161432361) is copper;1H-imidazole;sulfate.
What is the SMILES notation for copper;1H-imidazole;sulfate?
The canonical SMILES for copper;1H-imidazole;sulfate is O=S(=O)([O-])[O-].[Cu+2].c1c[nH]cn1.
What is the InChIKey of copper;1H-imidazole;sulfate?
The InChIKey is VYEOSHCSDHRUAB-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H4N2.Cu.H2O4S/c1-2-5-3-4-1;;1-5(2,3)4/h1-3H,(H,4,5);;(H2,1,2,3,4)/q;+2;/p-2.
What are the key properties of copper;1H-imidazole;sulfate?
copper;1H-imidazole;sulfate has a molecular weight of 227.69 g/mol, XLogP of -0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1H-imidazole;sulfate is sourced from PubChem (CID 161432361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).