About 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline
2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline (PubChem CID 161432629) has the molecular formula C13H13N3
and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline.
Molecular Properties
| Compound Name | 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline |
| PubChem CID | 161432629 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline |
| SMILES | c1cc(-c2ccc3c(n2)CCCC3)cnn1 |
| InChI | InChI=1S/C13H13N3/c1-2-4-12-10(3-1)5-6-13(16-12)11-7-8-14-15-9-11/h5-9H,1-4H2 |
| InChIKey | QIYPIWJEZUOXMF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline?
The IUPAC name of 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline (CID 161432629) is 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline.
What is the SMILES notation for 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline?
The canonical SMILES for 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline is c1cc(-c2ccc3c(n2)CCCC3)cnn1.
What is the InChIKey of 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline?
The InChIKey is QIYPIWJEZUOXMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3/c1-2-4-12-10(3-1)5-6-13(16-12)11-7-8-14-15-9-11/h5-9H,1-4H2.
What are the key properties of 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline?
2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline has a molecular weight of 211.27 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridazin-4-yl-5,6,7,8-tetrahydroquinoline is sourced from PubChem (CID 161432629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).