C35H40N2O2 — CID 161435366
1-[(8R,9S,10R)-10-butyl-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-6-yl]-2-(4-methoxyphenyl)ethanone (PubChem CID 161435366) has the molecular formula C35H40N2O2 and a molecular weight of 520.72 g/mol. Its IUPAC name is 1-[(8R,9S,10R)-10-butyl-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-6-yl]-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[(8R,9S,10R)-10-butyl-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-6-yl]-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 161435366 |
| Molecular Formula | C35H40N2O2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | 1-[(8R,9S,10R)-10-butyl-9-[4-(2-phenylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-6-yl]-2-(4-methoxyphenyl)ethanone |
| SMILES | CCCC[C@@H]1[C@H](c2ccc(C#Cc3ccccc3)cc2)[C@@H]2CN(C(=O)Cc3ccc(OC)cc3)CCCCN12 |
| InChI | InChI=1S/C35H40N2O2/c1-3-4-12-32-35(30-19-15-28(16-20-30)14-13-27-10-6-5-7-11-27)33-26-36(23-8-9-24-37(32)33)34(38)25-29-17-21-31(39-2)22-18-29/h5-7,10-11,15-22,32-33,35H,3-4,8-9,12,23-26H2,1-2H3/t32-,33+,35+/m1/s1 |
| InChIKey | QSFUBLHJGZWIMA-QDHDVKAFSA-N |
| XLogP | 6.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|