About [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane
[(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane (PubChem CID 161435631) has the molecular formula C22H33NO2Si
and a molecular weight of 371.60 g/mol. Its IUPAC name is [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane.
Molecular Properties
| Compound Name | [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane |
| PubChem CID | 161435631 |
| Molecular Formula | C22H33NO2Si |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane |
| SMILES | CC(C)(C)[SiH](c1ccccc1)c1ccccc1.N[C@@H]1CC[C@@H](CO)OC1 |
| InChI | InChI=1S/C16H20Si.C6H13NO2/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15;7-5-1-2-6(3-8)9-4-5/h4-13,17H,1-3H3;5-6,8H,1-4,7H2/t;5-,6+/m.1/s1 |
| InChIKey | VYPJTOLMHGCQTL-BCBTXJGPSA-N |
| XLogP | 2.31 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane?
The IUPAC name of [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane (CID 161435631) is [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane.
What is the SMILES notation for [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane?
The canonical SMILES for [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane is CC(C)(C)[SiH](c1ccccc1)c1ccccc1.N[C@@H]1CC[C@@H](CO)OC1.
What is the InChIKey of [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane?
The InChIKey is VYPJTOLMHGCQTL-BCBTXJGPSA-N. The full InChI is InChI=1S/C16H20Si.C6H13NO2/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15;7-5-1-2-6(3-8)9-4-5/h4-13,17H,1-3H3;5-6,8H,1-4,7H2/t;5-,6+/m.1/s1.
What are the key properties of [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane?
[(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane has a molecular weight of 371.60 g/mol, XLogP of 2.31, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-aminooxan-2-yl]methanol;tert-butyl(diphenyl)silane is sourced from PubChem (CID 161435631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).