About (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane
(1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane (PubChem CID 161437371) has the molecular formula C16H44OS2Si4
and a molecular weight of 429.01 g/mol. Its IUPAC name is (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane.
Molecular Properties
| Compound Name | (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane |
| PubChem CID | 161437371 |
| Molecular Formula | C16H44OS2Si4 |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane |
| SMILES | C[Si](C)(C)[Si](C[C@@H](O)C1CCCC1)([Si](C)(C)C)[Si](C)(C)C.S.S |
| InChI | InChI=1S/C16H40OSi4.2H2S/c1-18(2,3)21(19(4,5)6,20(7,8)9)14-16(17)15-12-10-11-13-15;;/h15-17H,10-14H2,1-9H3;2*1H2/t16-;;/m1../s1 |
| InChIKey | VYVBDPBEEBOSDB-GGMCWBHBSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane?
The IUPAC name of (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane (CID 161437371) is (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane.
What is the SMILES notation for (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane?
The canonical SMILES for (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane is C[Si](C)(C)[Si](C[C@@H](O)C1CCCC1)([Si](C)(C)C)[Si](C)(C)C.S.S.
What is the InChIKey of (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane?
The InChIKey is VYVBDPBEEBOSDB-GGMCWBHBSA-N. The full InChI is InChI=1S/C16H40OSi4.2H2S/c1-18(2,3)21(19(4,5)6,20(7,8)9)14-16(17)15-12-10-11-13-15;;/h15-17H,10-14H2,1-9H3;2*1H2/t16-;;/m1../s1.
What are the key properties of (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane?
(1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane has a molecular weight of 429.01 g/mol, XLogP of 5.46, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclopentyl-2-tris(trimethylsilyl)silylethanol;sulfane is sourced from PubChem (CID 161437371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).