C29H27Br2N3O4 — CID 161438359
2-acetyl-5-(2-bromophenyl)cyclohexane-1,3-dione;2-amino-7-(2-bromophenyl)-4-methyl-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 161438359) has the molecular formula C29H27Br2N3O4 and a molecular weight of 641.36 g/mol. Its IUPAC name is 2-acetyl-5-(2-bromophenyl)cyclohexane-1,3-dione;2-amino-7-(2-bromophenyl)-4-methyl-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | 2-acetyl-5-(2-bromophenyl)cyclohexane-1,3-dione;2-amino-7-(2-bromophenyl)-4-methyl-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 161438359 |
| Molecular Formula | C29H27Br2N3O4 |
| Molecular Weight | 641.36 g/mol |
| Exact Mass | 639.04 |
| IUPAC Name | 2-acetyl-5-(2-bromophenyl)cyclohexane-1,3-dione;2-amino-7-(2-bromophenyl)-4-methyl-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | CC(=O)C1C(=O)CC(c2ccccc2Br)CC1=O.Cc1nc(N)nc2c1C(=O)CC(c1ccccc1Br)C2 |
| InChI | InChI=1S/C15H14BrN3O.C14H13BrO3/c1-8-14-12(19-15(17)18-8)6-9(7-13(14)20)10-4-2-3-5-11(10)16;1-8(16)14-12(17)6-9(7-13(14)18)10-4-2-3-5-11(10)15/h2-5,9H,6-7H2,1H3,(H2,17,18,19);2-5,9,14H,6-7H2,1H3 |
| InChIKey | VYYCUHHIJDHPOS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.36 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|